CAS 74168-08-4
:Losmiprofen
Description:
Losmiprofen is a non-steroidal anti-inflammatory drug (NSAID) primarily used for its analgesic and anti-inflammatory properties. It is characterized by its ability to inhibit cyclooxygenase enzymes (COX-1 and COX-2), which play a crucial role in the synthesis of prostaglandins, compounds involved in inflammation and pain signaling. Losmiprofen is often utilized in the treatment of conditions such as arthritis, muscle pain, and other inflammatory disorders. The substance typically exhibits a moderate to high solubility in organic solvents, while its solubility in water is relatively low, which can influence its bioavailability. Its chemical structure includes a carboxylic acid functional group, contributing to its pharmacological activity. As with many NSAIDs, potential side effects may include gastrointestinal discomfort, cardiovascular risks, and renal impairment, particularly with prolonged use. Therefore, it is essential to use Losmiprofen under medical supervision, especially in patients with pre-existing health conditions.
Formula:C17H15ClO4
InChI:InChI=1/C17H15ClO4/c1-10-14(16(19)12-6-8-13(18)9-7-12)4-3-5-15(10)22-11(2)17(20)21/h3-9,11H,1-2H3,(H,20,21)
SMILES:Cc1c(cccc1OC(C)C(=O)O)C(=O)c1ccc(cc1)Cl
Synonyms:- Losmiprofen [INN]
- (+-)-2-((3-(p-Chlorobenzoyl)-o-tolyl)oxy)propionic acid
- 2-(3-(p-Chlorobenzoyl)-o-tolyloxy)propionic acid
- Brn 5759532
- Losmiprofene
- Losmiprofene [INN-French]
- Losmiprofeno
- Losmiprofeno [INN-Spanish]
- Losmiprofenum
- Losmiprofenum [INN-Latin]
- Unii-Gry6X9550R
- Propionic acid, 2-(3-(p-chlorobenzoyl)-o-tolyloxy)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Losmiprofen
CAS:Losmiprofen is a non-steroidal anti-inflammatory drug (NSAID) synthesized through pharmaceutical chemical processes. It is structurally designed to inhibit cyclooxygenase (COX) enzymes, which play a key role in the conversion of arachidonic acid to prostaglandins. Prostaglandins are lipid compounds that exacerbate inflammation, pain, and fever. By selectively acting on the COX enzymes, losmiprofen mitigates the synthesis of these mediators, thereby reducing inflammatory responses.
Formula:C17H15ClO4Purity:Min. 95%Molecular weight:318.7 g/molLosmiprofen
CAS:Losmiprofen is a nonsteroidal compound of antiinflammatory.Formula:C17H15ClO4Purity:98%Color and Shape:SolidMolecular weight:318.75

