CAS 741687-07-0

tert-butyl 4-amino-4-ethyl-piperidine-1-carboxylate

Description:

Tert-butyl 4-amino-4-ethyl-piperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl group and an ethyl substituent on the piperidine ring. This compound typically exhibits properties associated with amines and carboxylates, such as basicity due to the presence of the amino group and potential solubility in polar solvents. The tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interactions with biological systems. The presence of the carboxylate functional group suggests that it may participate in hydrogen bonding and ionic interactions, making it potentially useful in medicinal chemistry and drug design. Additionally, the compound's structure may confer specific pharmacological properties, making it of interest in the development of therapeutic agents. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be consulted when working with this substance.

Formula: C₁₂H₂₄N₂O₂

InChI: InChI=1/C12H24N2O2/c1-5-12(13)6-8-14(9-7-12)10(15)16-11(2,3)4/h5-9,13H2,1-4H3

SMILES: CCC1(CCN(CC1)C(=O)OC(C)(C)C)N

Synonyms:

• tert-Butyl 4-amino-4-ethylpiperidine-1-carboxylate

4-AMINO-1-N-BUTOXYCARBONYL-4-ETHYL-PIPERIDINE

CAS: 741687-07-0

Formula: C₁₂H₂₄N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 228.3312

Ref: IN-DA00FAQD

tert-Butyl 4-amino-4-ethylpiperidine-1-carboxylate

CAS: 741687-07-0

tert-Butyl 4-amino-4-ethylpiperidine-1-carboxylate

Purity: 96%

Molecular weight: 228.34g/mol

Ref: 54-OR1066598

tert-Butyl 4-amino-4-ethylpiperidine-1-carboxylate

CAS: 741687-07-0

Formula: C₁₂H₂₄N₂O₂

Purity: 96%

Color and Shape: No data available.

Molecular weight: 228.336

Ref: 10-F096280