CAS 741693-79-8
:2-methoxy-5-{[(1S)-3-(methylamino)-1-(thiophen-2-yl)propyl]oxy}naphthalen-1-ol
Description:
2-Methoxy-5-{[(1S)-3-(methylamino)-1-(thiophen-2-yl)propyl]oxy}naphthalen-1-ol is a complex organic compound characterized by its multi-functional structure, which includes a naphthalene core substituted with a methoxy group and a phenolic hydroxyl group. The presence of a thiophene ring and a methylamino group contributes to its potential biological activity, possibly influencing its interaction with various biological targets. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may affect its solubility and permeability in biological systems. Additionally, the stereochemistry indicated by the (1S) configuration suggests specific spatial arrangements that could be crucial for its pharmacological properties. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other disorders, given the presence of the methylamino group. Its CAS number, 741693-79-8, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry.
Formula:C19H21NO3S
InChI:InChI=1/C19H21NO3S/c1-20-11-10-16(18-7-4-12-24-18)23-15-6-3-5-14-13(15)8-9-17(22-2)19(14)21/h3-9,12,16,20-21H,10-11H2,1-2H3/t16-/m0/s1
SMILES:CNCC[C@@H](c1cccs1)Oc1cccc2c1ccc(c2O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-hydroxy-6-methoxy (S)-Duloxetine
CAS:5-Hydroxy-6-methoxy (S)-Duloxetine, a metabolite of (S)-duloxetine, binds to neurotransmitter transporters with varying affinities.Formula:C19H21NO3SColor and Shape:SolidMolecular weight:343.44

