CymitQuimica logo

CAS 741693-89-0

:

5-Fluoro-2-methoxy-1-naphthalenol

Description:
5-Fluoro-2-methoxy-1-naphthalenol is an organic compound characterized by its naphthalene structure, which consists of two fused benzene rings. The presence of a fluorine atom at the 5-position and a methoxy group at the 2-position contributes to its unique chemical properties. This compound features a hydroxyl (-OH) group, which enhances its solubility in polar solvents and can participate in hydrogen bonding. The fluorine substitution can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. As a naphthol derivative, it may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. The compound's molecular structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, 5-Fluoro-2-methoxy-1-naphthalenol represents a versatile compound with potential utility in research and development.
Formula:C11H9FO2
InChI:InChI=1S/C11H9FO2/c1-14-10-6-5-7-8(11(10)13)3-2-4-9(7)12/h2-6,13H,1H3
InChI key:InChIKey=LTKIXOQDXJPHOK-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC1OC)C(F)=CC=C2
Synonyms:
  • 1-Naphthalenol, 5-fluoro-2-methoxy-
  • 5-Fluoro-2-methoxy-1-naphthalenol
  • 1-Fluoro-6-methoxynaphth-5-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.