
CAS 741698-79-3
:4-Bromo-2-(1-methylpropyl)phenol
Description:
4-Bromo-2-(1-methylpropyl)phenol, with the CAS number 741698-79-3, is an organic compound characterized by its phenolic structure, which includes a bromine substituent and a branched alkyl group. This compound features a bromine atom attached to the aromatic ring, specifically at the para position relative to the hydroxyl group, which is located at the ortho position to the isobutyl group. The presence of the bromine atom enhances the compound's reactivity and may influence its biological activity. The hydroxyl group contributes to its classification as a phenol, imparting properties such as solubility in polar solvents and potential for hydrogen bonding. The branched alkyl group (1-methylpropyl) affects the compound's steric properties and hydrophobicity. Overall, 4-Bromo-2-(1-methylpropyl)phenol may exhibit interesting chemical behavior and potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and reactivity.
Formula:C10H13BrO
InChI:InChI=1S/C10H13BrO/c1-3-7(2)9-6-8(11)4-5-10(9)12/h4-7,12H,3H2,1-2H3
InChI key:InChIKey=XSERSFGASLGUTK-UHFFFAOYSA-N
SMILES:C(CC)(C)C1=C(O)C=CC(Br)=C1
Synonyms:- Phenol, 4-bromo-2-(1-methylpropyl)-
- 2-sec-Butyl-4-bromophenol
- 4-Bromo-2-(1-methylpropyl)phenol
- 4-Bromo-2-sec-butylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.