CAS 741698-80-6

N-(4-Fluorobenzyl)propan-1-amine

Description:

N-(4-Fluorobenzyl)propan-1-amine is an organic compound characterized by its amine functional group and a fluorobenzyl substituent. It features a propan-1-amine backbone, which consists of a three-carbon chain with an amine (-NH2) group at one end. The presence of the 4-fluorobenzyl group indicates that a fluorine atom is attached to the benzene ring at the para position relative to the benzyl carbon. This substitution can influence the compound's physical and chemical properties, such as its polarity, solubility, and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential applications in drug development, particularly in areas targeting neurotransmitter systems. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which may affect its interaction with biological targets. As with any chemical substance, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₁₄FN

InChI: InChI=1/C10H14FN/c1-2-7-12-8-9-3-5-10(11)6-4-9/h3-6,12H,2,7-8H2,1H3

SMILES: CCCNCc1ccc(cc1)F

Synonyms:

• benzenemethanamine, 4-fluoro-N-propyl-

[(4-fluorophenyl)methyl](propyl)amine

CAS: 741698-80-6

Formula: C₁₀H₁₄FN

Molecular weight: 167.2233

Ref: IN-DA003LFO

(4-fluorobenzyl)propylamine

CAS: 741698-80-6

Formula: C₁₀H₁₄FN

Purity: 95.0%

Molecular weight: 167.227

Ref: 10-F315831