CAS 741698-89-5

N-Cyclobutyl-3-furanmethanamine

Description:

N-Cyclobutyl-3-furanmethanamine is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a furan ring attached to a methanamine moiety. This compound typically exhibits properties associated with both cyclic and aromatic systems, such as potential reactivity due to the presence of the amine functional group. The cyclobutyl group contributes to its rigidity and may influence its conformational behavior, while the furan ring can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. The amine group may also engage in hydrogen bonding, affecting its solubility and interaction with other molecules. In terms of applications, compounds like N-Cyclobutyl-3-furanmethanamine may be explored in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise values.

Formula: C₉H₁₃NO

InChI: InChI=1S/C9H13NO/c1-2-9(3-1)10-6-8-4-5-11-7-8/h4-5,7,9-10H,1-3,6H2

InChI key: InChIKey=JTWANIKOUMBCKX-UHFFFAOYSA-N

SMILES: C(NC1CCC1)C=2C=COC2

Synonyms:

• 3-Furanmethanamine, N-cyclobutyl-
• N-Cyclobutyl-3-furanmethanamine