CAS 741698-95-3
:N-(Cyclopropylmethyl)-4-pyridinemethanamine
Description:
N-(Cyclopropylmethyl)-4-pyridinemethanamine, with the CAS number 741698-95-3, is a chemical compound characterized by its unique structure that includes a pyridine ring and a cyclopropylmethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the pyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often found in biologically active compounds. Additionally, the cyclopropyl group can impart distinct steric and electronic effects, potentially enhancing the compound's interaction with biological targets. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, N-(Cyclopropylmethyl)-4-pyridinemethanamine represents a class of compounds that may have significant implications in drug design and development.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-2-9(1)7-12-8-10-3-5-11-6-4-10/h3-6,9,12H,1-2,7-8H2
InChI key:InChIKey=ZXBAZWCQTQDZEB-UHFFFAOYSA-N
SMILES:C(NCC=1C=CN=CC1)C2CC2
Synonyms:- N-(Cyclopropylmethyl)-4-pyridinemethanamine
- 4-Pyridinemethanamine, N-(cyclopropylmethyl)-
- (Cyclopropylmethyl)[(pyridin-4-yl)methyl]amine
- 1-Cyclopropyl-N-(pyridin-4-ylmethyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.