CymitQuimica logo

CAS 741699-10-5

:

2-[2-(1-Methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetic acid

Description:
2-[2-(1-Methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetic acid, with CAS number 741699-10-5, is a chemical compound characterized by its complex structure that includes a phenoxy group and a dioxaborolane moiety. This compound typically exhibits properties associated with both organic acids and boron-containing compounds, which may influence its reactivity and solubility. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing pharmaceuticals. The isopropyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological systems. Additionally, the compound may exhibit specific biological activities, making it of interest in agricultural or therapeutic contexts. Its stability, solubility in various solvents, and reactivity with other chemical species would depend on the specific conditions under which it is used. Overall, this compound represents a unique intersection of organic chemistry and boron chemistry, with potential applications in various fields.
Formula:C17H25BO5
InChI:InChI=1S/C17H25BO5/c1-11(2)13-9-12(7-8-14(13)21-10-15(19)20)18-22-16(3,4)17(5,6)23-18/h7-9,11H,10H2,1-6H3,(H,19,20)
InChI key:InChIKey=KIMHQJDYFBEFJL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C(C)C)=C(OCC(O)=O)C=C2
Synonyms:
  • Acetic acid, [2-(1-methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-
  • 2-[2-(1-Methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetic acid
  • Acetic acid, 2-[2-(1-methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.