CymitQuimica logo

CAS 741709-71-7

:

2-Pyridinecarboxylic acid, 4-borono-, 2-ethyl ester, hydrochloride

Description:
2-Pyridinecarboxylic acid, 4-borono-, 2-ethyl ester, hydrochloride, identified by CAS number 741709-71-7, is a chemical compound that features a pyridine ring substituted with a carboxylic acid and a boronic acid moiety. This compound is typically characterized by its ability to form coordination complexes due to the presence of the boron atom, which can participate in various chemical reactions, including Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water and stability. The presence of the ethyl ester group suggests that it may exhibit different reactivity compared to its acid form, potentially influencing its biological activity. Overall, this compound is of interest in research areas such as drug development and materials science, where boron-containing compounds are increasingly recognized for their unique properties and applications.
Formula:C8H10BNO4·ClH
InChI:InChI=1S/C8H10BNO4.ClH/c1-2-14-8(11)7-5-6(9(12)13)3-4-10-7;/h3-5,12-13H,2H2,1H3;1H
InChI key:InChIKey=YSRXNLBUPKOAJE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(B(O)O)=CC=N1.Cl
Synonyms:
  • 2-Pyridinecarboxylic acid, 4-borono-, 2-ethyl ester, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.