
CAS 741716-20-1
:4-[(1-Ethyl-3-pyrrolidinyl)oxy]benzenamine
Description:
4-[(1-Ethyl-3-pyrrolidinyl)oxy]benzenamine, with the CAS number 741716-20-1, is a chemical compound characterized by its structure, which features a benzene ring substituted with an amino group and an ether linkage to a pyrrolidine derivative. This compound typically exhibits properties associated with both aromatic amines and cyclic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The pyrrolidine moiety may contribute to its pharmacological properties, potentially influencing its interaction with biological targets. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical and chemical behavior. Additionally, due to the presence of both an ether and an amine functional group, it may exhibit unique reactivity patterns in synthetic applications or biological systems. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-2-14-8-7-12(9-14)15-11-5-3-10(13)4-6-11/h3-6,12H,2,7-9,13H2,1H3
InChI key:InChIKey=XWRKRSUTFXAMKT-UHFFFAOYSA-N
SMILES:O(C1CN(CC)CC1)C2=CC=C(N)C=C2
Synonyms:- 4-[(1-Ethyl-3-pyrrolidinyl)oxy]benzenamine
- Benzenamine, 4-[(1-ethyl-3-pyrrolidinyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.