CAS 741719-53-9

4-{4-[(2R)-oxiran-2-ylmethoxy]-1,2,5-thiadiazol-3-yl}morpholine

Description:

4-{4-[(2R)-oxiran-2-ylmethoxy]-1,2,5-thiadiazol-3-yl}morpholine is a chemical compound characterized by its unique structural features, which include a morpholine ring and a thiadiazole moiety. The presence of the epoxide group (oxirane) contributes to its reactivity, making it potentially useful in various chemical reactions, including those involving nucleophilic attack. This compound may exhibit biological activity due to its complex structure, which can interact with biological targets. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The thiadiazole ring is known for its diverse biological properties, including antimicrobial and anti-inflammatory activities. Additionally, the morpholine ring can enhance solubility and bioavailability. The compound's specific properties, such as solubility, stability, and reactivity, would depend on environmental conditions and the presence of other functional groups. Overall, this compound represents a class of heterocyclic compounds that are of interest in both synthetic and medicinal chemistry.

Formula: C₉H₁₃N₃O₃S

InChI: InChI=1/C9H13N3O3S/c1-3-13-4-2-12(1)8-9(11-16-10-8)15-6-7-5-14-7/h7H,1-6H2/t7-/m1/s1

SMILES: C1COCCN1c1c(nsn1)OC[C@H]1CO1

Timolol Impurity 13

CAS: 741719-53-9

Formula: C₉H₁₃N₃O₃S

Molecular weight: 243.28

Ref: 4Z-T-6830