CAS 741729-99-7

Methyl 7-azaspiro[3.5]nonane-2-carboxylate

Description:

Methyl 7-azaspiro[3.5]nonane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom integrated into a bicyclic framework. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The azaspiro structure imparts interesting stereochemical properties, which can influence its biological activity and interactions. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, depending on the substituents and the overall molecular architecture. Methyl 7-azaspiro[3.5]nonane-2-carboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.

Formula: C₁₀H₁₇NO₂

InChI: InChI=1S/C10H17NO2/c1-13-9(12)8-6-10(7-8)2-4-11-5-3-10/h8,11H,2-7H2,1H3

InChI key: InChIKey=RLLNKDKSEKTZBF-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CC2(C1)CCNCC2

Synonyms:

• Methyl 7-azaspiro[3.5]nonane-2-carboxylate
• 7-Azaspiro[3.5]nonane-2-carboxylic acid, methyl ester