CAS 74173-51-6
:5-fluoro-2,4-dioxo-N-(5-oxohexyl)-3,4-dihydropyrimidine-1(2H)-carboxamide
Description:
5-Fluoro-2,4-dioxo-N-(5-oxohexyl)-3,4-dihydropyrimidine-1(2H)-carboxamide is a synthetic organic compound characterized by its pyrimidine core, which features a fluorine substituent and a carboxamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the dioxo groups suggests it may participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. The long alkyl chain (5-oxohexyl) may influence its solubility and lipophilicity, potentially affecting its pharmacokinetic properties if used in medicinal chemistry. Additionally, the fluorine atom can enhance metabolic stability and bioactivity. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its unique structural features and potential biological implications. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C11H14FN3O4
InChI:InChI=1/C11H14FN3O4/c1-7(16)4-2-3-5-13-10(18)15-6-8(12)9(17)14-11(15)19/h6H,2-5H2,1H3,(H,13,18)(H,14,17,19)
SMILES:CC(=O)CCCCN=C(n1cc(c(nc1=O)O)F)O
Synonyms:- 1(2H)-Pyrimidinecarboxamide, 5-fluoro-3,4-dihydro-2,4-dioxo-N-(5-oxohexyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.