CAS 74173-76-5

2,4-dichloro-6-iodoquinazoline

Description:

2,4-Dichloro-6-iodoquinazoline is a heterocyclic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring. This compound features two chlorine atoms at the 2 and 4 positions and an iodine atom at the 6 position of the quinazoline ring, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of halogen substituents often enhances the compound's lipophilicity and can influence its interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, 2,4-dichloro-6-iodoquinazoline may possess antimicrobial or anticancer properties, although specific biological activities would require empirical investigation. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a valuable scaffold for further research in pharmaceutical applications.

Formula: C₈H₃Cl₂IN₂

InChI: InChI=1/C8H3Cl2IN2/c9-7-5-3-4(11)1-2-6(5)12-8(10)13-7/h1-3H

SMILES: c1cc2c(cc1I)c(Cl)nc(Cl)n2

Synonyms:

• 6-Iodo-2,4-dichloroquinazoline
• Quinazoline, 2,4-dichloro-6-iodo-

2,4-dichloro-6-iodoquinazoline

CAS: 74173-76-5

Formula: C₈H₃Cl₂IN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 324.9333

Ref: IN-DA005NM7

2,4-Dichloro-6-iodoquinazoline

CAS: 74173-76-5

2,4-Dichloro-6-iodoquinazoline

Purity: 97%

Molecular weight: 324.93g/mol

Ref: 54-OR81355

2,4-Dichloro-6-iodoquinazoline

CAS: 74173-76-5

Purity: 97%

Molecular weight: 324.9299927

Ref: 10-F609499