CAS 741737-00-8
:3,5-Dibromo-6-(trifluoromethyl)-2(1H)-pyridinone
Description:
3,5-Dibromo-6-(trifluoromethyl)-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group. The presence of two bromine atoms at the 3 and 5 positions, along with a trifluoromethyl group at the 6 position, significantly influences its chemical properties, including its reactivity and polarity. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The bromine substituents can enhance the compound's lipophilicity, while the trifluoromethyl group can improve metabolic stability and bioavailability. Additionally, the compound may exhibit interesting interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Its CAS number, 741737-00-8, allows for easy identification in chemical databases and literature. Overall, 3,5-Dibromo-6-(trifluoromethyl)-2(1H)-pyridinone is notable for its unique structural features and potential applications in various fields of chemistry and pharmacology.
Formula:C6H2Br2F3NO
InChI:InChI=1S/C6H2Br2F3NO/c7-2-1-3(8)5(13)12-4(2)6(9,10)11/h1H,(H,12,13)
InChI key:InChIKey=ONPVCAKATJHKGR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C=C(Br)C(=O)N1
Synonyms:- 3,5-Dibromo-2-hydroxy-6-trifluoromethyl-pyridine
- 3,5-Dibromo-6-(trifluoromethyl)-1,2-dihydropyridin-2-one
- 3,5-Dibromo-6-(trifluoromethyl)-1H-pyridin-2-one
- 3,5-Dibromo-6-(trifluoromethyl)-2(1H)-pyridinone
- 3,5-Dibromo-6-(trifluoromethyl)pyridin-2(1H)-one
- 3,5-Dibromo-6-(trifluoromethyl)pyridin-2-ol
- 2(1H)-Pyridinone, 3,5-dibromo-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.