CymitQuimica logo

CAS 741737-01-9

:

3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine

Description:
3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two bromine substituents at the 3 and 5 positions, a methoxy group (-OCH3) at the 2 position, and a trifluoromethyl group (-CF3) at the 6 position. The presence of these functional groups contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. The trifluoromethyl group is known for enhancing the compound's biological activity and stability, while the bromine atoms can serve as sites for further substitution reactions. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. Additionally, its specific structural features may influence its solubility, boiling point, and reactivity, making it a subject of study in various chemical contexts.
Formula:C7H4Br2F3NO
InChI:InChI=1S/C7H4Br2F3NO/c1-14-6-4(9)2-3(8)5(13-6)7(10,11)12/h2H,1H3
InChI key:InChIKey=FXTPBHSJYSTYIS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(OC)C(Br)=CC1Br
Synonyms:
  • 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine
  • Pyridine, 3,5-dibromo-2-methoxy-6-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.