CAS 74174-29-1
:3-(4-hydroxy-2,3-dimethoxyphenyl)-2H-chromen-7-ol
Description:
3-(4-Hydroxy-2,3-dimethoxyphenyl)-2H-chromen-7-ol, with the CAS number 74174-29-1, is a chemical compound that belongs to the class of flavonoids, specifically a chromenol derivative. This compound features a chromen-7-ol core, which is characterized by a benzopyran structure, and is substituted with a 4-hydroxy-2,3-dimethoxyphenyl group. The presence of hydroxyl and methoxy groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmacological studies. The compound may exhibit various biological activities, including anti-inflammatory and anticancer effects, due to its ability to interact with cellular pathways. Its solubility and stability can be influenced by the functional groups present, which also affect its reactivity and potential applications in medicinal chemistry. Overall, this compound represents a significant area of research in natural products and synthetic chemistry, with implications for drug development and therapeutic applications.
Formula:C17H16O5
InChI:InChI=1/C17H16O5/c1-20-16-13(5-6-14(19)17(16)21-2)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-8,18-19H,9H2,1-2H3
Synonyms:- haginin A
- 2H-1-Benzopyran-7-ol, 3-(4-hydroxy-2,3-dimethoxyphenyl)-
- NSC360042
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Haginin A
CAS:Haginin A inhibits hyperpigmentation and skin disorders, reduces tyrosinase/TRP-1, and has antioxidant properties.Formula:C17H16O5Purity:98%Color and Shape:SolidMolecular weight:300.31Haginin A
CAS:<p>Haginin A is a flavonoid compound, which is a natural product derived from certain botanical sources. As a bioactive molecule, its primary mode of action involves the inhibition of tyrosinase, an enzyme pivotal in the melanin synthesis pathway. By impeding this enzyme's activity, Haginin A effectively reduces melanin production, resulting in skin lightening and depigmentation.</p>Formula:C17H16O5Purity:Min. 95%Molecular weight:300.3 g/mol

