CAS 74174-50-8
:(T-4)-Trichloro(N,N-dipropyl-1-propanamine)boron
Description:
(T-4)-Trichloro(N,N-dipropyl-1-propanamine)boron, with the CAS number 74174-50-8, is a chemical compound that belongs to the class of organoboron compounds. It features a boron atom coordinated to three chlorine atoms and an amine group, specifically N,N-dipropyl-1-propanamine. This compound is characterized by its unique structure, which allows it to participate in various chemical reactions, particularly in organic synthesis and catalysis. The presence of the boron atom contributes to its reactivity, making it useful in applications such as Lewis acid catalysis. Additionally, the dipropylamine moiety enhances its solubility in organic solvents, which is beneficial for its use in various chemical processes. Safety considerations are important when handling this compound, as it may pose health risks due to its chlorine content and potential reactivity. Overall, (T-4)-Trichloro(N,N-dipropyl-1-propanamine)boron is a versatile compound with applications in synthetic chemistry and materials science.
Formula:C9H21BCl3N
InChI:InChI=1S/C9H21BCl3N/c1-4-7-14(8-5-2,9-6-3)10(11,12)13/h4-9H2,1-3H3
InChI key:InChIKey=TZCURLZOHOVBND-UHFFFAOYSA-N
SMILES:[N]([B+3]([Cl-])([Cl-])[Cl-])(CCC)(CCC)CCC
Synonyms:- Borane, trichloro-, compd. with N,N-dipropyl-1-propanamine (1:1)
- (T-4)-Trichloro(N,N-dipropyl-1-propanamine)boron
- 1-Propanamine, N,N-dipropyl-, compd. with trichloroborane (1:1)
- 1-Propanamine, N,N-dipropyl-, boron complex
- Boron, trichloro(N,N-dipropyl-1-propanamine)-, (T-4)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
