CAS 7418-33-9
:N-Methyl-N-(2-nitrophenyl)acetamide
Description:
N-Methyl-N-(2-nitrophenyl)acetamide, with the CAS number 7418-33-9, is an organic compound characterized by its amide functional group, which features a methyl group and a nitrophenyl substituent. This compound typically appears as a solid or crystalline substance, and its molecular structure includes a nitrogen atom bonded to both a methyl group and an acetamide moiety, along with a nitro group attached to the aromatic ring. The presence of the nitro group contributes to its potential reactivity and polarity, influencing its solubility in various solvents. N-Methyl-N-(2-nitrophenyl)acetamide may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and purity. As with many nitro compounds, it may require careful handling due to potential toxicity and environmental impact. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C9H10N2O3
InChI:InChI=1S/C9H10N2O3/c1-7(12)10(2)8-5-3-4-6-9(8)11(13)14/h3-6H,1-2H3
InChI key:InChIKey=KYRBLTADDMVJTF-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C)C1=C(N(=O)=O)C=CC=C1
Synonyms:- N-Methyl-N-(2-nitrophenyl)acetamide
- Acetamide, N-methyl-N-(2-nitrophenyl)-
- N-Methyl-2′-nitroacetanilide
- o-Nitro-N-methylacetanilide
- Acetanilide, N-methyl-2′-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.