CAS 7418-44-2

N-(4-acetyl-2-nitrophenyl)acetamide

Description:

N-(4-acetyl-2-nitrophenyl)acetamide, with the CAS number 7418-44-2, is an organic compound characterized by its aromatic structure, which includes a nitro group and an acetyl group attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests it may exhibit both electrophilic and nucleophilic properties due to the presence of the nitro and acetamide functional groups. The nitro group can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the acetyl group may impart certain stability and solubility characteristics. This compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or as an intermediate in the synthesis of other chemical entities. Safety data should be consulted, as compounds containing nitro groups can be sensitive and may pose health risks if not handled properly.

Formula: C₁₀H₁₀N₂O₄

InChI: InChI=1/C10H10N2O4/c1-6(13)8-3-4-9(11-7(2)14)10(5-8)12(15)16/h3-5H,1-2H3,(H,11,14)

SMILES: CC(=O)c1ccc(c(c1)N(=O)=O)N=C(C)O

Synonyms:

• acetamide, N-(4-acetyl-2-nitrophenyl)-
• N-(4-Acetyl-2-nitrophenyl)acetamide
• 4-ACETAMIDO-3-NITROACETOPHENONE