CAS 74192-47-5

4-Amino-3-cyanobenzoic acid

Description:

4-Amino-3-cyanobenzoic acid, also known by its IUPAC name, is an aromatic compound characterized by the presence of an amino group (-NH2) and a cyano group (-CN) attached to a benzoic acid structure. This compound features a carboxylic acid (-COOH) functional group, which contributes to its acidic properties. The amino group is typically a weak base, while the cyano group is a strong electron-withdrawing group, influencing the compound's reactivity and solubility. It is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. The presence of both the amino and cyano groups allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 4-Amino-3-cyanobenzoic acid may exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the compound. Proper handling and storage are essential due to its potential reactivity and biological effects.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-3H,10H2,(H,11,12)

InChI key: InChIKey=SCDUHKOJSMYVPO-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(C(O)=O)=CC=C1N

Synonyms:

• Benzoic acid, 4-amino-3-cyano-
• 4-Amino-3-cyanobenzoic acid

4-Amino-3-cyanobenzoic acid

CAS: 74192-47-5

Formula: C₈H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA005Z2X

4-Amino-3-cyanobenzoic acid

CAS: 74192-47-5

4-Amino-3-cyanobenzoic acid

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.15g/mol

Ref: 54-OR47861

4-Amino-3-cyanobenzoic acid

CAS: 74192-47-5

Formula: C₈H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.148

Ref: 10-F339781