
CAS 74197-18-5
:2H-Indazol-5-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)
Description:
2H-Indazol-5-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The presence of the amine group indicates that it has basic properties, allowing it to form salts, such as the hydrochloride form, which enhances its solubility in water. This compound is typically a white to off-white crystalline solid. Its tetrahydro configuration suggests that it has undergone partial hydrogenation, resulting in a saturated structure that may influence its reactivity and biological activity. The hydrochloride salt form is commonly used in pharmaceutical applications due to improved stability and bioavailability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would depend on further research and characterization. Safety data and handling precautions should be observed, as with all chemical substances.
Formula:C7H11N3·2ClH
InChI:InChI=1S/C7H11N3.2ClH/c8-6-1-2-7-5(3-6)4-9-10-7;;/h4,6H,1-3,8H2,(H,9,10);2*1H
InChI key:InChIKey=IHDUZMHOIVQJGL-UHFFFAOYSA-N
SMILES:NC1CC=2C(CC1)=NNC2.Cl
Synonyms:- 2H-Indazol-5-amine, 4,5,6,7-tetrahydro-, dihydrochloride
- 2H-Indazol-5-amine, 4,5,6,7-tetrahydro-, dihydrochloride, (±)-
- 2H-Indazol-5-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
