CAS 74198-19-9
:12-Methyl-2,5,8,11-tetraoxatridecan-13-ol
Description:
12-Methyl-2,5,8,11-tetraoxatridecan-13-ol is a chemical compound characterized by its unique structure, which includes a long carbon chain with multiple ether linkages and a hydroxyl group. The presence of four ether functional groups contributes to its potential solubility in polar solvents, while the hydroxyl group enhances its reactivity and ability to form hydrogen bonds. This compound is likely to exhibit properties typical of polyethers, such as low volatility and moderate thermal stability. Its molecular structure suggests it may have applications in various fields, including materials science and pharmaceuticals, due to its potential as a surfactant or as a building block for more complex molecules. Additionally, the presence of the methyl group may influence its physical properties, such as melting and boiling points, as well as its overall reactivity. However, specific data regarding its toxicity, environmental impact, and detailed physical properties would require further investigation or empirical studies.
Formula:C10H22O5
InChI:InChI=1S/C10H22O5/c1-10(9-11)15-8-7-14-6-5-13-4-3-12-2/h10-11H,3-9H2,1-2H3
InChI key:InChIKey=QFYJXYBADYVKQN-UHFFFAOYSA-N
SMILES:C(COC(CO)C)OCCOCCOC
Synonyms:- 12-Methyl-2,5,8,11-tetraoxatridecan-13-ol
- 2,5,8,11-Tetraoxatridecan-13-ol, 12-methyl-
- 2-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
