CAS 7420-16-8
:4-oxatetradecanoic acid
Description:
4-Oxatetradecanoic acid, also known as 4-oxatetradecanoic acid, is a fatty acid derivative characterized by its long carbon chain and the presence of an oxygen atom in a cyclic ether structure. This compound features a 14-carbon backbone, typical of fatty acids, with a ketone functional group at the fourth carbon position, which contributes to its unique chemical properties. The presence of the oxygen atom in the chain can influence its solubility, reactivity, and potential applications in various fields, including biochemistry and materials science. It is generally a colorless to pale yellow liquid or solid, depending on temperature, and exhibits typical fatty acid behavior, such as forming esters and amides. The compound may also participate in various chemical reactions, including oxidation and reduction, due to the presence of the carbonyl group. Its applications may extend to the synthesis of surfactants, emulsifiers, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C13H26O3
InChI:InChI=1/C13H26O3/c1-2-3-4-5-6-7-8-9-11-16-12-10-13(14)15/h2-12H2,1H3,(H,14,15)
SMILES:CCCCCCCCCCOCCC(=O)O
Synonyms:- Propanoic acid, 3-(decyloxy)-
- 3-(Decyloxy)Propanoic Acid
- 4-Oxatetradecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Oxatetradecanoic Acid
CAS:Controlled ProductApplications 4-Oxatetradecanoic acid is an analog of myristate that inhibits HIV replication.
Formula:C13H26O3Color and Shape:NeatMolecular weight:230.34

