CymitQuimica logo

CAS 7420-35-1

:

3-bromobenzaldehyde thiosemicarbazone

Description:
3-Bromobenzaldehyde thiosemicarbazone is an organic compound characterized by the presence of a thiosemicarbazone functional group attached to a bromobenzaldehyde moiety. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The thiosemicarbazone group, derived from thiosemicarbazide and an aldehyde, contributes to the compound's reactivity and ability to form coordination complexes with metal ions, which can enhance its pharmacological effects. The presence of the bromine atom in the benzaldehyde ring can influence the compound's electronic properties and reactivity, making it a subject of interest in medicinal chemistry. Additionally, 3-bromobenzaldehyde thiosemicarbazone may exhibit solubility in various organic solvents, which can be advantageous for its application in synthesis and biological assays. Overall, this compound serves as a valuable scaffold in the development of new therapeutic agents and is of interest in both academic and pharmaceutical research.
Formula:C8H8BrN3S
InChI:InChI=1/C8H8BrN3S/c9-7-3-1-2-6(4-7)5-11-12-8(10)13/h1-5H,(H3,10,12,13)/b11-5+
Synonyms:
  • (2E)-2-(3-Bromobenzylidene)hydrazinecarbimidothioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.