
CAS 7420-86-2
:2-Phenyl-5-methylbenzoxazole
Description:
2-Phenyl-5-methylbenzoxazole is an organic compound characterized by its heterocyclic structure, which includes a benzoxazole ring fused with a phenyl group and a methyl substituent. This compound typically exhibits a pale yellow to light brown appearance and is known for its fluorescence properties, making it of interest in various applications, including organic light-emitting diodes (OLEDs) and as a fluorescent probe in biochemical assays. The presence of the benzoxazole moiety contributes to its stability and potential reactivity, particularly in the context of forming complexes with metal ions. Additionally, 2-Phenyl-5-methylbenzoxazole may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to its hydrophobic characteristics. The compound's unique structure allows for various substitution patterns, which can influence its electronic properties and reactivity, making it a subject of interest in synthetic organic chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H11NO
InChI:InChI=1S/C14H11NO/c1-10-7-8-13-12(9-10)15-14(16-13)11-5-3-2-4-6-11/h2-9H,1H3
InChI key:InChIKey=RDBLNMQDEWOUIB-UHFFFAOYSA-N
SMILES:CC=1C=C2N=C(OC2=CC1)C3=CC=CC=C3
Synonyms:- 2-Phenyl-5-methylbenzoxazole
- 5-Methyl-2-phenylbenzo[d]oxazole
- Witisol
- 5-Methyl-2-phenylbenzoxazole
- Benzoxazole, 5-methyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.