CAS 742000-78-8
:phenyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
Phenyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, identified by its CAS number 742000-78-8, is a synthetic organic compound characterized by its complex structure, which includes a phenyl group, a pyrrolidine moiety, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the pyrrolidine ring suggests that it may exhibit basic properties due to the nitrogen atom, which can participate in hydrogen bonding and influence solubility in various solvents. Additionally, the ketone functional group can engage in nucleophilic addition reactions, making it a versatile intermediate in organic synthesis. Its molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its applications and safety profile. As with any chemical substance, proper handling and safety precautions should be observed.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c20-18(15-8-2-1-3-9-15)17-11-5-4-10-16(17)14-19-12-6-7-13-19/h1-5,8-11H,6-7,12-14H2
SMILES:c1ccc(cc1)C(=O)c1ccccc1CN1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.