CAS 74202-10-1

Uplandicine

Description:

Uplandicine, with the CAS number 74202-10-1, is a naturally occurring alkaloid derived from certain plant species, particularly those in the genus *Uplandia*. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Uplandicine exhibits a range of pharmacological properties, including antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action is often linked to its ability to interact with various biological targets, potentially influencing cellular signaling pathways. The substance is typically studied in the context of natural product chemistry, where its extraction, purification, and synthesis are explored to understand its therapeutic potential. Additionally, research into uplandicine may involve assessing its safety profile, bioavailability, and efficacy in various biological systems. As with many natural compounds, further studies are necessary to fully elucidate its properties and potential applications in medicine.

Formula: C₁₇H₂₇NO₇

InChI: InChI=1S/C17H27NO7/c1-10(19)17(23,16(3,4)22)15(21)24-9-12-5-7-18-8-6-13(14(12)18)25-11(2)20/h5,10,13-14,19,22-23H,6-9H2,1-4H3/t10-,13+,14+,17-/m0/s1

InChI key: InChIKey=IHRIHUJNKKMIDN-YYGKBEQOSA-N

SMILES: C(OC([C@]([C@@](C)(C)O)([C@H](C)O)O)=O)C=1[C@]2(N(CC[C@H]2OC(C)=O)CC1)[H]

Synonyms:

• Uplandicine
• 7-Acetyl-9-echimidinylretronecine
• 3-C-[[[(1R,7aR)-1-(Acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methoxy]carbonyl]-1,5-dideoxy-2-C-methyl-L-threo-pentitol
• L-threo-Pentitol, 3-C-[[[(1R,7aR)-1-(acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methoxy]carbonyl]-1,5-dideoxy-2-C-methyl-

Uplandicine

CAS: 74202-10-1

Please enquire for more information about Uplandicine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₇NO₇

Purity: Min. 95%

Molecular weight: 357.4 g/mol

Ref: 3D-ZCA20210