CAS 74205-55-3
:3-Ethoxyphenylacetonitrile
Description:
3-Ethoxyphenylacetonitrile, with the CAS number 74205-55-3, is an organic compound characterized by its aromatic structure and the presence of both an ethoxy group and a nitrile functional group. It features a phenyl ring substituted at the 3-position with an ethoxy group (–OCH2CH3) and an acetonitrile group (–C≡N) attached to the phenyl ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. 3-Ethoxyphenylacetonitrile may be utilized in various chemical syntheses and research applications, particularly in the fields of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the nitrile group, which can participate in nucleophilic addition reactions, while the ethoxy group can affect the compound's overall polarity and solubility characteristics. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-2-12-10-5-3-4-9(8-10)6-7-11/h3-5,8H,2,6H2,1H3
SMILES:CCOc1cccc(CC#N)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
