
CAS 742051-91-8
:Cyclopropanamine, 1-(phenoxymethyl)-
Description:
Cyclopropanamine, 1-(phenoxymethyl)- is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring known for its strain and reactivity. The presence of the amine functional group indicates that it can act as a base and participate in hydrogen bonding, influencing its solubility and reactivity. The phenoxymethyl substituent introduces an aromatic ring, which can enhance the compound's stability and influence its electronic properties. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its unique combination of a strained cyclopropane and an aromatic moiety could lead to distinctive chemical behavior, including potential interactions with biological targets. As with many amines, it may also be sensitive to oxidation and can participate in various chemical reactions, such as alkylation or acylation. Overall, Cyclopropanamine, 1-(phenoxymethyl)- presents a fascinating example of how structural elements can dictate the properties and potential applications of a chemical substance.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-10(6-7-10)8-12-9-4-2-1-3-5-9/h1-5H,6-8,11H2
InChI key:InChIKey=DSEKLEWAEDYRCM-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C2(N)CC2
Synonyms:- Cyclopropanamine, 1-(phenoxymethyl)-
- 1-(Phenoxymethyl)cyclopropan-1-amine
- 1-(Phenoxymethyl)cyclopropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.