CAS 742058-39-5

2-Benzyloxy-5-bromopyrimidine

Description:

2-Benzyloxy-5-bromopyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The compound features a benzyl ether group at the 2-position and a bromine atom at the 5-position of the pyrimidine ring, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as dichloromethane or ethanol, while being less soluble in water due to its hydrophobic benzyl group. The presence of the bromine atom can enhance its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to ensure safety and stability, as well as to prevent degradation or unwanted reactions.

Formula: C₁₁H₉BrN₂O

InChI: InChI=1/C11H9BrN2O/c12-10-6-13-11(14-7-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2

SMILES: c1ccc(cc1)COc1ncc(cn1)Br

2-(Benzyloxy)-5-bromopyrimidine

CAS: 742058-39-5

Formula: C₁₁H₉BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.1060

Ref: IN-DA005DDO

2-Benzyloxy-5-bromopyrimidine

CAS: 742058-39-5

2-Benzyloxy-5-bromopyrimidine

Purity: 98%

Molecular weight: 265.11g/mol

Ref: 54-OR96088

2-Benzyloxy-5-bromopyrimidine

CAS: 742058-39-5

Heterocyclic Compounds - Pyrimidine; Intermediates and Building Blocks - Electrophile

Formula: C₁₁H₉BrN₂O

Color and Shape: Solid

Molecular weight: 265.11

Ref: TM-TNU0818

2-(Benzyloxy)-5-bromopyrimidine

CAS: 742058-39-5

Formula: C₁₁H₉BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.11

Ref: 10-F329210