CAS 74208-85-8

1-amino-3-(3-fluorophenyl)pyrrolidine-2,5-dione

Description:

1-Amino-3-(3-fluorophenyl)pyrrolidine-2,5-dione, with the CAS number 74208-85-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with an amino group and a 3-fluorophenyl group. This compound features a diketopiperazine-like framework, which contributes to its potential biological activity. The presence of the fluorine atom in the phenyl ring can enhance lipophilicity and influence the compound's interaction with biological targets. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential applications in drug development. The amino and carbonyl functionalities can participate in various chemical reactions, making this compound a versatile intermediate in organic synthesis. Additionally, the specific arrangement of atoms and functional groups may impart unique pharmacological properties, warranting further investigation into its efficacy and safety in biological systems. Overall, 1-amino-3-(3-fluorophenyl)pyrrolidine-2,5-dione represents a compound of interest for researchers in the fields of organic chemistry and pharmacology.

Formula: C₁₀H₉FN₂O₂

InChI: InChI=1/C10H9FN2O2/c11-7-3-1-2-6(4-7)8-5-9(14)13(12)10(8)15/h1-4,8H,5,12H2

SMILES: c1cc(cc(c1)F)C1CC(=O)N(C1=O)N