CAS 742085-16-1

(4-chlorophenyl)[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (4-chlorophenyl)[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 742085-16-1, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a pyrrolidinylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which often enhance stability and melting points. The chlorophenyl moiety may impart specific electronic properties, influencing reactivity and interactions with biological targets. Additionally, the pyrrolidine ring suggests potential for interactions with neurotransmitter systems, making it of interest in medicinal chemistry. The compound's solubility may vary depending on the solvent, and it may exhibit moderate to high lipophilicity due to its hydrophobic aromatic components. Overall, this substance could be relevant in pharmaceutical research, particularly in the development of new therapeutic agents.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1/C18H18ClNO/c19-17-9-7-16(8-10-17)18(21)15-5-3-14(4-6-15)13-20-11-1-2-12-20/h3-10H,1-2,11-13H2

SMILES: C1CCN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1)Cl