CAS 74209-23-7

3,7-Dichloro-5-nitro-1H-indazole

Description:

3,7-Dichloro-5-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two chlorine atoms at the 3 and 7 positions, along with a nitro group at the 5 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chlorinated and nitro-substituted nature suggests potential applications in pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. The presence of halogens and nitro groups often influences the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,7-Dichloro-5-nitro-1H-indazole is a notable compound in the realm of synthetic organic chemistry.

Formula: C₇H₃Cl₂N₃O₂

InChI: InChI=1S/C7H3Cl2N3O2/c8-5-2-3(12(13)14)1-4-6(5)10-11-7(4)9/h1-2H,(H,10,11)

InChI key: InChIKey=BIOWNMPWORNJAG-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=C(Cl)C=C(N(=O)=O)C2)NN1

Synonyms:

• 3,7-Dichloro-5-nitro-1H-indazole
• 1H-Indazole, 3,7-dichloro-5-nitro-