CAS 74209-34-0
:3-bromo-7-nitro-2H-indazole
Description:
3-Bromo-7-nitro-2H-indazole is a chemical compound characterized by its unique structure, which includes a bromine atom and a nitro group attached to an indazole ring system. The indazole moiety is a bicyclic structure composed of a five-membered ring fused to a six-membered ring, contributing to the compound's aromatic properties. The presence of the bromine atom typically enhances the compound's reactivity, making it useful in various synthetic applications, while the nitro group can serve as a functional handle for further chemical modifications. This compound is often studied in the context of medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Additionally, its solubility and stability in different solvents can vary, influencing its application in research and industry. As with many halogenated and nitro-substituted compounds, safety precautions should be taken when handling 3-bromo-7-nitro-2H-indazole, as it may pose health risks or environmental hazards.
Formula:C7H4BrIN2
InChI:InChI=1/C7H4BrIN2/c8-7-4-2-1-3-5(9)6(4)10-11-7/h1-3H,(H,10,11)
SMILES:c1cc2c(c(c1)I)[nH]nc2Br
Synonyms:- 1H-Indazole, 3-bromo-7-nitro-
- 3-Bromo-7-nitro-1H-indazole
- 3-bromo-7-iodo-2H-indazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Bromo-7-nitroindazole, 98+%
CAS:Inhibitor of nitric oxide synthase (NOS)Formula:C7H4BrN3O2Purity:98+%Color and Shape:Yellow, PowderMolecular weight:242.03-Bromo-7-nitro-1H-indazole
CAS:Formula:C7H4BrN3O2Purity:97%Color and Shape:SolidMolecular weight:242.02963-Bromo-7-nitroindazole
CAS:3-Bromo-7-nitroindazoleFormula:C7H4BrN3O2Purity:≥95%Color and Shape: pale brown solidMolecular weight:242.03g/mol3-Bromo-7-nitroindazole
CAS:Controlled ProductApplications 3-Bromo-7-nitroindazole is a potent and selective neuronal nitric oxide synthase (nNOS) inhibitor (1,2). It is also a neuroprotective compound that inhibits the endoplasmic reticulum stress pathway. 3-Bromo-7-nitroindazole has been used to study the role of nitric oxide synthase (nNOS) in spatial memory formation in rats (2).
References (1) Srinivasan, K. and Sharma, S. S.: Life Sci. (2012) 90:154-60(2) Gocmez, S. S., et al.: Pharmacol Biochem Behav. (2015) 131:19-25.Formula:C7H4BrN3O2Color and Shape:NeatMolecular weight:242.033-Bromo-7-Nitroindazole
CAS:M01376 - 3-Bromo-7-Nitroindazole
Formula:C7H4BrN3O2Purity:97%Color and Shape:SolidMolecular weight:242.0323-Bromo-7-nitroindazole
CAS:3-Bromo-7-nitroindazole specifically inhibits nNOS, impacting NO synthesis in brain/body.Formula:C7H4BrN3O2Purity:98.2%Color and Shape:Yellowish SolidMolecular weight:242.03






