CAS 74209-44-2
:2,2-diethoxy-2-(pyridin-4-yl)ethanamine
Description:
2,2-Diethoxy-2-(pyridin-4-yl)ethanamine, with the CAS number 74209-44-2, is an organic compound characterized by its unique structure, which includes a pyridine ring and two ethoxy groups attached to a central ethanamine backbone. This compound typically exhibits properties associated with both amines and ethers, such as moderate solubility in polar solvents due to the presence of the ethoxy groups, while the pyridine moiety may contribute to its basicity and potential for coordination with metal ions. The presence of the pyridine ring also suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often involved in biological activity. Additionally, the compound may exhibit interesting reactivity patterns due to the functional groups present, making it a candidate for further chemical transformations. Overall, 2,2-diethoxy-2-(pyridin-4-yl)ethanamine is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C11H18N2O2
InChI:InChI=1/C11H18N2O2/c1-3-14-11(9-12,15-4-2)10-5-7-13-8-6-10/h5-8H,3-4,9,12H2,1-2H3
SMILES:CCOC(CN)(c1ccncc1)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.