
CAS 742094-72-0
:4-(2,5-Dimethylphenyl)-2,4-dihydro-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one
Description:
4-(2,5-Dimethylphenyl)-2,4-dihydro-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a quinazolinone core fused with a triazole ring. This compound features a thioxo group, contributing to its potential reactivity and biological activity. The presence of the 2,5-dimethylphenyl substituent enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the fields of anti-cancer and anti-inflammatory research, due to their ability to interact with biological targets. The thioxo group may also impart unique properties, such as increased stability or specific interactions with enzymes or receptors. As with many heterocycles, the compound's solubility, melting point, and reactivity can vary significantly based on its molecular structure and substituents. Further studies, including in vitro and in vivo assays, are essential to fully elucidate its biological activity and potential applications in medicinal chemistry.
Formula:C17H14N4OS
InChI:InChI=1S/C17H14N4OS/c1-10-7-8-11(2)14(9-10)20-15(22)12-5-3-4-6-13(12)21-16(20)18-19-17(21)23/h3-9H,1-2H3,(H,19,23)
InChI key:InChIKey=XTMDGOQQHMSFBA-UHFFFAOYSA-N
SMILES:O=C1N(C=2N(C=3C1=CC=CC3)C(=S)NN2)C4=C(C)C=CC(C)=C4
Synonyms:- [1,2,4]Triazolo[4,3-a]quinazolin-5(1H)-one, 4-(2,5-dimethylphenyl)-2,4-dihydro-1-thioxo-
- 4-(2,5-Dimethylphenyl)-2,4-dihydro-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.