CymitQuimica logo

CAS 742094-75-3

:

4-(2-Furanylmethyl)-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione

Description:
4-(2-Furanylmethyl)-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a furan moiety, contributing to its potential reactivity and biological activity. The presence of a methoxyphenoxy group enhances its solubility and may influence its pharmacological properties. As a thione, it contains a sulfur atom double-bonded to a carbon atom, which can impart distinct chemical reactivity, particularly in nucleophilic substitution reactions. The compound's structure suggests potential applications in medicinal chemistry, possibly as an antifungal or antibacterial agent, due to the presence of the triazole ring, which is known for its bioactivity. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C15H15N3O3S
InChI:InChI=1S/C15H15N3O3S/c1-19-11-4-6-12(7-5-11)21-10-14-16-17-15(22)18(14)9-13-3-2-8-20-13/h2-8H,9-10H2,1H3,(H,17,22)
InChI key:InChIKey=JWEQEZQZUGSODU-UHFFFAOYSA-N
SMILES:C(N1C(COC2=CC=C(OC)C=C2)=NNC1=S)C3=CC=CO3
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 4-(2-furanylmethyl)-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-
  • 4-(2-Furanylmethyl)-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.