CAS 742107-59-1

(αS)-3,4-Dichloro-α-ethylbenzenemethanol

Description:

(αS)-3,4-Dichloro-α-ethylbenzenemethanol, with the CAS number 742107-59-1, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a dichlorobenzene ring, indicating the presence of two chlorine atoms substituted on the aromatic ring, which can significantly influence its reactivity and physical properties. The α-ethyl group suggests that there is an ethyl substituent attached to the carbon adjacent to the alcohol functional group, which contributes to the compound's hydrophobic characteristics. The presence of the hydroxyl (-OH) group classifies it as an alcohol, which can engage in hydrogen bonding, affecting its solubility in polar solvents. The stereochemistry denoted by (αS) indicates a specific spatial arrangement of atoms, which can impact the compound's biological activity and interactions with other molecules. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, where the specific arrangement of functional groups can lead to desired biological effects.

Formula: C₉H₁₀Cl₂O

InChI: InChI=1S/C9H10Cl2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5,9,12H,2H2,1H3/t9-/m0/s1

InChI key: InChIKey=PJYGECCAJOYJMK-VIFPVBQESA-N

SMILES: [C@@H](CC)(O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• Benzenemethanol, 3,4-dichloro-α-ethyl-, (αS)-
• (αS)-3,4-Dichloro-α-ethylbenzenemethanol