
CAS 74213-42-6
:4,4,5,5-Tetramethyl-2-[(trimethylsilyl)methyl]-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-[(trimethylsilyl)methyl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure, which includes two boron atoms and a dioxolane-like framework. This compound features a trimethylsilyl group, enhancing its stability and solubility in organic solvents. The presence of multiple methyl groups contributes to its steric bulk, which can influence its reactivity and interactions with other molecules. Typically, compounds like this are utilized in organic synthesis, particularly in reactions involving boron chemistry, such as cross-coupling reactions or as intermediates in the preparation of more complex organic molecules. The dioxaborolane structure is known for its ability to form stable complexes with various nucleophiles, making it a valuable building block in synthetic organic chemistry. Additionally, its properties may include moderate volatility and a relatively low melting point, typical of similar organoboron compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H23BO2Si
InChI:InChI=1S/C10H23BO2Si/c1-9(2)10(3,4)13-11(12-9)8-14(5,6)7/h8H2,1-7H3
InChI key:InChIKey=ROVMHMGRSYLCTP-UHFFFAOYSA-N
SMILES:C([Si](C)(C)C)B1OC(C)(C)C(C)(C)O1
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(trimethylsilyl)methyl]-
- 4,4,5,5-Tetramethyl-2-[(trimethylsilyl)methyl]-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(trimethylsilyl)methyl]-
CAS:Formula:C10H23BO2SiMolecular weight:214.1849
