CAS 74213-96-0
:4-(2-nitroethyl)phenyl hexopyranoside
Description:
4-(2-Nitroethyl)phenyl hexopyranoside is a chemical compound characterized by its structure, which includes a hexopyranoside sugar moiety linked to a phenyl group that is further substituted with a nitroethyl group. This compound typically exhibits properties associated with both its sugar and aromatic components, such as solubility in polar solvents and potential biological activity due to the presence of the nitro group. The nitro group can influence the compound's reactivity and may participate in various chemical reactions, including reduction or nucleophilic substitution. Additionally, the hexopyranoside structure suggests that it may engage in hydrogen bonding and other intermolecular interactions, which can affect its physical properties like melting point and solubility. The compound's potential applications could span fields such as medicinal chemistry, where it may serve as a lead compound for drug development or as a tool in biochemical research. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C14H19NO8
InChI:InChI=1/C14H19NO8/c16-7-10-11(17)12(18)13(19)14(23-10)22-9-3-1-8(2-4-9)5-6-15(20)21/h1-4,10-14,16-19H,5-7H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thalictoside
CAS:Thalictoside, found in A. squamosa L, is a soluble epoxide hydrolase (sEH) inhibitor with an IC50 of 20.2 µM. It exhibits anti-osteoporotic effects by modulating estrogen-like mechanisms and is valuable in research on cardiovascular and urinary system diseases.Formula:C14H19NO8Molecular weight:329.30
