CAS 74214-63-4

9H-Pyrido[3,4-b]indole-3-carboxylic acid

Description:

9H-Pyrido[3,4-b]indole-3-carboxylic acid is a heterocyclic compound characterized by its fused pyridine and indole structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and allows for potential interactions in biological systems. The presence of nitrogen atoms in the pyridine and indole rings can influence its reactivity and ability to form hydrogen bonds, making it a candidate for various chemical reactions and applications in medicinal chemistry. Additionally, the compound may exhibit interesting biological activities, potentially serving as a scaffold for drug development. Its molecular structure suggests that it could participate in π-π stacking interactions and other non-covalent interactions, which are significant in the context of molecular recognition and binding. Overall, 9H-Pyrido[3,4-b]indole-3-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₂H₈N₂O₂

InChI: InChI=1S/C12H8N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-6,14H,(H,15,16)

InChI key: InChIKey=ARLVFKCLBYUINL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C=3C(NC2=CN1)=CC=CC3

Synonyms:

• 3-Carboxy-β-carboline
• 9H-Pyrido[3,4-b]indole-3-carboxylic acid
• NSC 623957
• β-Carboline-3-carboxylic acid
• Norharmane-3-carboxylic acid

9H-Pyrido[3,4-b]indole-3-carboxylic acid

CAS: 74214-63-4

Versatile small molecule scaffold

Formula: C₁₂H₈N₂O₂

Purity: Min. 95%

Molecular weight: 212.2 g/mol

Ref: 3D-ZCA21463