CAS 74220-53-4
:p-[[(4-chlorobutyl)sulphonyl]amino]benzenesulphonamide
Description:
p-[[4-Chlorobutyl)sulphonyl]amino]benzenesulphonamide, identified by its CAS number 74220-53-4, is a sulphonamide compound characterized by the presence of both sulphonyl and amino functional groups. This compound typically exhibits properties associated with sulphonamides, such as potential antibacterial activity, due to the sulphonamide moiety. The presence of the chlorobutyl group suggests that it may have hydrophobic characteristics, which can influence its solubility and biological activity. The compound's structure indicates that it may participate in hydrogen bonding due to the amino and sulphonyl groups, potentially affecting its reactivity and interactions with biological targets. Additionally, the chlorobutyl substituent may enhance lipophilicity, impacting its pharmacokinetic properties. Overall, this compound's unique structural features suggest it could have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C10H15ClN2O4S2
InChI:InChI=1/C10H15ClN2O4S2/c11-7-1-2-8-18(14,15)13-9-3-5-10(6-4-9)19(12,16)17/h3-6,13H,1-2,7-8H2,(H2,12,16,17)
InChI key:InChIKey=JAWCYQCOPVFEDM-UHFFFAOYSA-N
SMILES:C(CCS(=O)(=O)Nc1ccc(cc1)S(=O)(=O)N)CCl
Synonyms:- 4-[[(4-chlorobutyl)sulfonyl]amino]-Benzenesulfonamide
- Benzenesulfonamide, 4-[[(4-chlorobutyl)sulfonyl]amino]-
- p-(((4-Chlorobutyl)sulphonyl)amino)benzenesulphonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
