
CAS 74223-56-6
:Sulfometuron
Description:
Sulfometuron is a selective herbicide primarily used for controlling annual and perennial grasses and broadleaf weeds in various crops, particularly in agricultural settings. It belongs to the sulfonylurea class of herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for the synthesis of essential amino acids in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Sulfometuron is characterized by its systemic action, allowing it to be absorbed by plant roots and foliage, providing effective control even in challenging conditions. It is typically applied pre-emergence or post-emergence, depending on the specific application and target species. The compound is generally stable under normal environmental conditions but can degrade in the presence of strong acids or bases. Its use is regulated, and safety measures are recommended to minimize potential environmental impact and human exposure. As with all herbicides, proper application techniques and adherence to guidelines are essential for effective and responsible use.
Formula:C14H14N4O5S
InChI:InChI=1S/C14H14N4O5S/c1-8-7-9(2)16-13(15-8)17-14(21)18-24(22,23)11-6-4-3-5-10(11)12(19)20/h3-7H,1-2H3,(H,19,20)(H2,15,16,17,18,21)
InChI key:InChIKey=FZMKKCQHDROFNI-UHFFFAOYSA-N
SMILES:S(NC(NC=1N=C(C)C=C(C)N1)=O)(=O)(=O)C2=C(C(O)=O)C=CC=C2
Synonyms:- Sulfometuron
- Benzoic acid, 2-[[[[(4,6-dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-
- 2-[[[[(4,6-Dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
