
CAS 74226-22-5
:Dazoxiben hydrochloride
Description:
Dazoxiben hydrochloride is a chemical compound primarily recognized for its role as a selective serotonin reuptake inhibitor (SSRI) and is often studied for its potential therapeutic applications in the treatment of various psychiatric disorders. It is characterized by its hydrochloride salt form, which enhances its solubility in water, making it suitable for pharmaceutical formulations. The compound exhibits a specific molecular structure that contributes to its pharmacological activity, particularly in modulating serotonin levels in the brain. Dazoxiben hydrochloride is typically administered in controlled doses, and its efficacy and safety profile are evaluated through clinical studies. As with many pharmaceuticals, it is essential to consider its side effects, interactions with other medications, and contraindications. The compound is also subject to regulatory oversight to ensure its quality and safety for human use. Overall, Dazoxiben hydrochloride represents a significant interest in medicinal chemistry, particularly in the context of developing treatments for mood disorders.
Formula:C12H13ClN2O3
InChI:InChI=1/C12H12N2O3.ClH/c15-12(16)10-1-3-11(4-2-10)17-8-7-14-6-5-13-9-14;/h1-6,9H,7-8H2,(H,15,16);1H
InChI key:InChIKey=PVKDFUXBDJPRGU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(OCCN2C=CN=C2)C=C1.Cl
Synonyms:- 1-[2-(4-Carboxyphenoxy)ethyl]imidazole monohydrochloride
- 4-[2-(1H-imidazol-1-yl)ethoxy]benzoic acid hydrochloride (1:1)
- Benzoic acid, 4-[2-(1H-imidazol-1-yl)ethoxy]-, hydrochloride (1:1)
- Benzoic acid, 4-[2-(1H-imidazol-1-yl)ethoxy]-, monohydrochloride
- Dazoxiben hydrochloride
- Dazoxiben monohydrochloride
- Uk 37248
- Uk-37248-01
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dazoxiben
CAS:Dazoxiben (UK-37248) is a potent inhibitor of thromboxane (TX) synthase
Formula:C12H13ClN2O3Purity:99.99%Color and Shape:SolidMolecular weight:268.74-(2-(1H-Imidazol-1-yl)ethoxy)benzoic acid hydrochloride
CAS:4-(2-(1H-Imidazol-1-yl)ethoxy)benzoic acid hydrochloride is a synthetic chemical compound, which is typically sourced through organic synthesis methods. This compound is characterized by its unique structure featuring an imidazole group linked to a benzoic acid moiety via an ethoxy bridge. The mode of action of this compound predominantly involves interactions at a molecular level with various biological targets, potentially influencing biochemical pathways by mimicking or inhibiting natural biological molecules.
Formula:C12H13ClN2O3Purity:Min. 95%Molecular weight:268.69 g/molRef: 3D-ZCA22622
Discontinued product




