CAS 7423-53-2

1,3,5-tris(3-chloro-2-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione

Description:

1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione, commonly referred to by its CAS number 7423-53-2, is a chemical compound characterized by its triazine core structure, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features three 3-chloro-2-hydroxypropyl substituents, which contribute to its hydrophilic properties and potential reactivity. The presence of hydroxyl groups enhances its solubility in polar solvents and may facilitate hydrogen bonding. The chlorinated groups can impart antimicrobial properties, making it of interest in various applications, including as a biocide or in agricultural formulations. Additionally, the triazine moiety is known for its stability and resistance to degradation, which can be advantageous in certain formulations. Overall, this compound's unique structure and functional groups suggest potential utility in fields such as agriculture, materials science, and pharmaceuticals, although specific applications would depend on further research and development.

Formula: C₁₂H₁₈Cl₃N₃O₆

InChI: InChI=1/C12H18Cl3N3O6/c13-1-7(19)4-16-10(22)17(5-8(20)2-14)12(24)18(11(16)23)6-9(21)3-15/h7-9,19-21H,1-6H2

SMILES: C(C(Cn1c(=O)n(CC(CCl)O)c(=O)n(CC(CCl)O)c1=O)O)Cl

1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione-d15

Controlled Product

CAS: 7423-53-2

Applications 1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione-d15 is an intermediate for the synthesis of Triglycidyl Isocyanurate-d15 (T793817). Isotope labelled Triglycidyl isocyanurate is a reagent used in the synthesis of N-Benzyl Metaxalone (B285000), which is a muscle relaxant used to relax muscles and relieve pain.
References Toth, P.E., et al.: Clin. Ther., 26, 1355 (2004)

Formula: C₁₂D₁₅H₃Cl₃N₃O₆

Color and Shape: Neat

Molecular weight: 421.739

Ref: TR-C793837