CymitQuimica logo

CAS 7423-53-2

:

1,3,5-tris(3-chloro-2-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione

Description:
1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione, commonly referred to by its CAS number 7423-53-2, is a chemical compound characterized by its triazine core structure, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features three 3-chloro-2-hydroxypropyl substituents, which contribute to its hydrophilic properties and potential reactivity. The presence of hydroxyl groups enhances its solubility in polar solvents and may facilitate hydrogen bonding. The chlorinated groups can impart antimicrobial properties, making it of interest in various applications, including as a biocide or in agricultural formulations. Additionally, the triazine moiety is known for its stability and resistance to degradation, which can be advantageous in certain formulations. Overall, this compound's unique structure and functional groups suggest potential utility in fields such as agriculture, materials science, and pharmaceuticals, although specific applications would depend on further research and development.
Formula:C12H18Cl3N3O6
InChI:InChI=1/C12H18Cl3N3O6/c13-1-7(19)4-16-10(22)17(5-8(20)2-14)12(24)18(11(16)23)6-9(21)3-15/h7-9,19-21H,1-6H2
SMILES:C(C(Cn1c(=O)n(CC(CCl)O)c(=O)n(CC(CCl)O)c1=O)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione-d15

    Controlled Product
    CAS:

    Applications 1,3,5-Tris(3-chloro-2-hydroxypropyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione-d15 is an intermediate for the synthesis of Triglycidyl Isocyanurate-d15 (T793817). Isotope labelled Triglycidyl isocyanurate is a reagent used in the synthesis of N-Benzyl Metaxalone (B285000), which is a muscle relaxant used to relax muscles and relieve pain.
    References Toth, P.E., et al.: Clin. Ther., 26, 1355 (2004)

    Formula:C12D15H3Cl3N3O6
    Color and Shape:Neat
    Molecular weight:421.739

    Ref: TR-C793837

    10mg
    1,022.00€