
CAS 74234-11-0
:3-(3',4'-Methylenedioxybenzoyl)-2'-deoxy-5-fluoro-uridine
Description:
3-(3',4'-Methylenedioxybenzoyl)-2'-deoxy-5-fluoro-uridine, with the CAS number 74234-11-0, is a synthetic nucleoside analog that incorporates a fluorine atom at the 5-position of the uridine base. This modification enhances its potential as an antiviral or anticancer agent by altering its interaction with nucleic acid synthesis pathways. The methylenedioxybenzoyl group contributes to its lipophilicity, potentially improving cellular uptake and bioavailability. The compound exhibits characteristics typical of nucleoside analogs, including the ability to interfere with nucleic acid metabolism, which can lead to inhibition of viral replication or cancer cell proliferation. Its structure suggests that it may also exhibit unique pharmacological properties due to the presence of the methylenedioxy moiety, which can influence binding affinity to various biological targets. Overall, this compound represents a class of molecules that are of significant interest in medicinal chemistry for their therapeutic potential.
Formula:C17H15FN2O8
InChI:InChI=1/C17H15FN2O8/c18-9-5-19(14-4-10(22)13(6-21)28-14)17(25)20(16(9)24)15(23)8-1-2-11-12(3-8)27-7-26-11/h1-3,5,10,13-14,21-22H,4,6-7H2/t10-,13+,14+/m0/s1
Synonyms:- Tk-117
- 3-(1,3-Benzodioxol-5-Ylcarbonyl)-2'-Deoxy-5-Fluorouridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.