![(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]oct-6-yl acetate](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F305034-1r-2s-5r-6s-2-hydroxy-8-azabicyclo-3-2-1-oct-6-yl-acetate.webp&w=3840&q=75)
CAS 74239-84-2
:(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]oct-6-yl acetate
Description:
The chemical substance known as (1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]oct-6-yl acetate, with the CAS number 74239-84-2, is a bicyclic compound characterized by its unique structural framework, which includes a bicyclo[3.2.1]octane core with an azabicyclic structure. This compound features a hydroxyl group (-OH) at the 2-position and an acetate group (-OCOCH3) at the 6-position, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the (1R,2S,5R,6S) configuration suggests specific spatial arrangements of its substituents, which can significantly influence its interaction with biological targets, such as receptors or enzymes. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural characteristics that can mimic natural substrates or ligands. Its solubility, stability, and reactivity would depend on the specific conditions, including pH and solvent, making it a subject of interest for further research in organic and medicinal chemistry.
Formula:C9H15NO3
InChI:InChI=1/C9H15NO3/c1-5(11)13-9-4-7-8(12)3-2-6(9)10-7/h6-10,12H,2-4H2,1H3/t6-,7-,8+,9+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Baogongteng A
CAS:Baogongteng A is an alkaloid compound, which is extracted from the plant Stephania kwangsiensis, a member of the Menispermaceae family. This compound is primarily obtained through the isolation of phytochemicals native to the plant, involving processes that ensure the preservation of its bioactive properties.
Formula:C9H15NO3Purity:Min. 95%Molecular weight:185.22 g/mol
