CAS 74266-66-3
:4-bromo-2-fluoro-6-nitroanisole
Description:
4-Bromo-2-fluoro-6-nitroanisole is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and multiple halogen and nitro substituents. The presence of bromine and fluorine atoms introduces significant electronegativity, influencing the compound's reactivity and polarity. The nitro group (-NO2) is a strong electron-withdrawing group, which can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of substituents can impart specific properties, such as increased stability under certain conditions and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's structure suggests potential for further functionalization, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C7H5BrFNO3
InChI:InChI=1/C7H5BrFNO3/c1-13-7-5(9)2-4(8)3-6(7)10(11)12/h2-3H,1H3
SMILES:COc1c(cc(cc1N(=O)=O)Br)F
Synonyms:- 4-Bromo-2-Fluoro-6-Nitrophenyl Methyl Ether
- 5-Bromo-1-Fluoro-2-Methoxy-3-Nitro-Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2-fluoro-6-nitroanisole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrFNO3Purity:97%Color and Shape:Yellow to brown, Crystals or powder or crystalline powderMolecular weight:250.024-Bromo-2-fluoro-6-nitroanisole
CAS:Formula:C7H5BrFNO3Purity:95%Color and Shape:SolidMolecular weight:250.02194-Bromo-2-fluoro-6-nitroanisole
CAS:4-Bromo-2-fluoro-6-nitroanisolePurity:≥95%Color and Shape:PowderMolecular weight:250.02g/mol



